Changeset 07347cb in rtems


Ignore:
Timestamp:
Jan 7, 2004, 5:48:16 PM (17 years ago)
Author:
Ralf Corsepius <ralf.corsepius@…>
Branches:
4.10, 4.11, 4.8, 4.9, 5, master
Children:
74a67351
Parents:
e7d110ba
Message:

2004-01-07 Ralf Corsepius <corsepiu@…>

  • Makefile.am: Build library using EXTRA_LIBRARIES and automake rules.
Location:
cpukit
Files:
22 edited

Legend:

Unmodified
Added
Removed
  • cpukit/itron/ChangeLog

    re7d110ba r07347cb  
     12004-01-07  Ralf Corsepius <corsepiu@faw.uni-ulm.de>
     2
     3        * Makefile.am: Build library using EXTRA_LIBRARIES and automake rules.
     4
    152003-12-12      Ralf Corsepius <corsepiu@faw.uni-ulm.de>
    26
  • cpukit/itron/Makefile.am

    re7d110ba r07347cb  
    44
    55include $(top_srcdir)/automake/multilib.am
    6 include $(top_srcdir)/automake/compile.am
    7 include $(top_srcdir)/automake/lib.am
     6include $(top_srcdir)/automake/amcompile.am
    87
    98EXTRA_DIST =
     
    6564## Sources
    6665
    67 LIB=$(ARCH)/libitron.a
    68 
    6966TASK_C_FILES = src/task.c src/cre_tsk.c src/del_tsk.c src/sta_tsk.c \
    7067    src/ext_tsk.c src/exd_tsk.c src/ter_tsk.c src/dis_dsp.c src/ena_dsp.c \
     
    104101    $(VARIABLE_MEMORY_POOL_C_FILES) $(FIXED_MEMORY_POOL_C_FILES) \
    105102    $(TIME_C_FILES)
    106 OBJS = $(C_FILES:src/%.c=${ARCH}/%.$(OBJEXT))
    107103
    108104AM_CPPFLAGS += -I$(top_builddir)
    109105AM_CPPFLAGS += -D__RTEMS_INSIDE__
    110106
    111 all-local: $(PREINSTALL_FILES) ${LIB}
    112 
    113 $(LIB): ${OBJS}
    114         $(make-library)
     107EXTRA_LIBRARIES = o-optimize/libitron.a
     108o_optimize_libitron_a_SOURCES = $(C_FILES)
     109o_optimize_libitron_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_OPTIMIZE_V)
     110
     111EXTRA_LIBRARIES += o-debug/libitron.a
     112o_debug_libitron_a_SOURCES = $(C_FILES)
     113o_debug_libitron_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_DEBUG_V)
     114
     115all-local: $(PREINSTALL_FILES) $(ARCH)/libitron.a
    115116endif
    116 
    117 ${ARCH}/%.$(OBJEXT): src/%.c $(ARCH)/$(dirstamp)
    118         ${COMPILE} -o $@ -c $<
    119117
    120118UNUSED_C_FILES = src/cre_mbx.c src/del_mbx.c src/mboxtranslatereturncode.c \
  • cpukit/libblock/ChangeLog

    re7d110ba r07347cb  
     12004-01-07  Ralf Corsepius <corsepiu@faw.uni-ulm.de>
     2
     3        * Makefile.am: Build library using EXTRA_LIBRARIES and automake rules.
     4
    152003-12-12      Ralf Corsepius <corsepiu@faw.uni-ulm.de>
    26
  • cpukit/libblock/Makefile.am

    re7d110ba r07347cb  
    44
    55include $(top_srcdir)/automake/multilib.am
    6 include $(top_srcdir)/automake/compile.am
    7 include $(top_srcdir)/automake/lib.am
     6include $(top_srcdir)/automake/amcompile.am
    87
    98include_rtemsdir = $(includedir)/rtems
     
    1312    include/rtems/ide_part_table.h
    1413
    15 LIB = ${ARCH}/libblock.a
    16 
    1714C_FILES = src/bdbuf.c src/blkdev.c src/diskdevs.c src/ramdisk.c \
    1815    src/ide_part_table.c
    1916
    20 OBJS = $(C_FILES:src/%.c=${ARCH}/%.$(OBJEXT))
     17EXTRA_LIBRARIES = o-optimize/libblock.a
     18o_optimize_libblock_a_SOURCES = $(C_FILES)
     19o_optimize_libblock_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_OPTIMIZE_V)
     20
     21EXTRA_LIBRARIES += o-debug/libblock.a
     22o_debug_libblock_a_SOURCES = $(C_FILES)
     23o_debug_libblock_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_DEBUG_V)
    2124
    2225AM_CPPFLAGS += -I$(top_builddir)
    2326AM_CPPFLAGS += $(LIBC_DEFINES)
    2427
    25 ${ARCH}/%.$(OBJEXT): src/%.c $(ARCH)/$(dirstamp)
    26         ${COMPILE} -o $@ -c $<
    27 
    28 $(LIB): ${OBJS}
    29         $(make-library)
    30 
    31 all-local: $(PREINSTALL_FILES) $(LIB)
     28all-local: $(PREINSTALL_FILES) $(ARCH)/libblock.a
    3229
    3330PREINSTALL_FILES =
  • cpukit/libcsupport/ChangeLog

    re7d110ba r07347cb  
     12004-01-07  Ralf Corsepius <corsepiu@faw.uni-ulm.de>
     2
     3        * Makefile.am: Build library using EXTRA_LIBRARIES and automake rules.
     4
    152003-12-16      Joel Sherrill <joel@OARcorp.com>
    26
  • cpukit/libcsupport/Makefile.am

    re7d110ba r07347cb  
    44
    55include $(top_srcdir)/automake/multilib.am
    6 include $(top_srcdir)/automake/compile.am
    7 include $(top_srcdir)/automake/lib.am
     6include $(top_srcdir)/automake/amcompile.am
    87
    98include_HEADERS = include/chain.h include/console.h include/clockdrv.h \
     
    3534
    3635include_sysdir = $(includedir)/sys
    37 
     36include_sys_HEADERS = include/sys/ioccom.h
     37
     38if NEWLIB
    3839# FIXME: We should not install to include/sys unless using newlib.
    39 include_sys_HEADERS = include/sys/filio.h include/sys/ioccom.h \
    40     include/sys/ioctl.h include/sys/sockio.h include/sys/ttycom.h
    41 
    42 if NEWLIB
     40include_sys_HEADERS += include/sys/filio.h include/sys/ioctl.h \
     41    include/sys/sockio.h include/sys/ttycom.h
    4342include_sys_HEADERS += include/sys/termios.h include/sys/utsname.h
    4443endif
     
    5655
    5756##  General stuff
    58 all-local: $(PREINSTALL_FILES)
    59 
    60 LIB = ${ARCH}/libcsupport.a
     57all-local: $(PREINSTALL_FILES) $(ARCH)/libcsupport.a
    6158
    6259AM_CPPFLAGS += -I$(top_builddir)
     
    123120endif
    124121
    125 OBJS = $(C_FILES:src/%.c=${ARCH}/%.$(OBJEXT))
    126 
    127 #
    128 # Add local stuff here using +=
    129 #
    130 
    131122AM_CFLAGS += $(LIBC_DEFINES)
    132123
    133 all-local: ${LIB}
    134 
    135 ${ARCH}/%.$(OBJEXT): src/%.c $(ARCH)/$(dirstamp)
    136         ${COMPILE} -o $@ -c $<
    137 
    138 $(LIB): ${OBJS}
    139         $(make-library)
     124EXTRA_LIBRARIES = o-optimize/libcsupport.a
     125o_optimize_libcsupport_a_SOURCES = $(C_FILES)
     126o_optimize_libcsupport_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_OPTIMIZE_V)
     127
     128EXTRA_LIBRARIES += o-debug/libcsupport.a
     129o_debug_libcsupport_a_SOURCES = $(C_FILES)
     130o_debug_libcsupport_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_DEBUG_V)
    140131
    141132DOC_FILES = src/TODO src/CASES
     
    246237        @: > $(PROJECT_INCLUDE)/sys/$(dirstamp)
    247238
     239$(PROJECT_INCLUDE)/sys/ioccom.h: include/sys/ioccom.h $(PROJECT_INCLUDE)/sys/$(dirstamp)
     240        $(INSTALL_DATA) $< $(PROJECT_INCLUDE)/sys/ioccom.h
     241PREINSTALL_FILES += $(PROJECT_INCLUDE)/sys/ioccom.h
     242
     243if NEWLIB
    248244$(PROJECT_INCLUDE)/sys/filio.h: include/sys/filio.h $(PROJECT_INCLUDE)/sys/$(dirstamp)
    249245        $(INSTALL_DATA) $< $(PROJECT_INCLUDE)/sys/filio.h
    250246PREINSTALL_FILES += $(PROJECT_INCLUDE)/sys/filio.h
    251247
    252 $(PROJECT_INCLUDE)/sys/ioccom.h: include/sys/ioccom.h $(PROJECT_INCLUDE)/sys/$(dirstamp)
    253         $(INSTALL_DATA) $< $(PROJECT_INCLUDE)/sys/ioccom.h
    254 PREINSTALL_FILES += $(PROJECT_INCLUDE)/sys/ioccom.h
    255 
    256248$(PROJECT_INCLUDE)/sys/ioctl.h: include/sys/ioctl.h $(PROJECT_INCLUDE)/sys/$(dirstamp)
    257249        $(INSTALL_DATA) $< $(PROJECT_INCLUDE)/sys/ioctl.h
     
    266258PREINSTALL_FILES += $(PROJECT_INCLUDE)/sys/ttycom.h
    267259
    268 if NEWLIB
    269260$(PROJECT_INCLUDE)/sys/termios.h: include/sys/termios.h $(PROJECT_INCLUDE)/sys/$(dirstamp)
    270261        $(INSTALL_DATA) $< $(PROJECT_INCLUDE)/sys/termios.h
  • cpukit/libfs/ChangeLog

    re7d110ba r07347cb  
     12004-01-07  Ralf Corsepius <corsepiu@faw.uni-ulm.de>
     2
     3        * Makefile.am: Build library using EXTRA_LIBRARIES and automake rules.
     4
    152003-12-12      Ralf Corsepius <corsepiu@faw.uni-ulm.de>
    26
  • cpukit/libfs/Makefile.am

    re7d110ba r07347cb  
    44
    55include $(top_srcdir)/automake/multilib.am
    6 include $(top_srcdir)/automake/compile.am
    7 include $(top_srcdir)/automake/lib.am
     6include $(top_srcdir)/automake/amcompile.am
    87
    98AM_CPPFLAGS += -I$(top_builddir)
     
    1514
    1615# imfs
    17 
    1816libimfs_EMBEDDED_C_FILES = src/imfs/imfs_chown.c src/imfs/imfs_config.c \
    1917    src/imfs/imfs_creat.c src/imfs/imfs_directory.c src/imfs/imfs_eval.c \
     
    3937libimfs_C_FILES = $(libimfs_EMBEDDED_C_FILES)
    4038endif
    41 libimfs_OBJS = $(libimfs_C_FILES:src/imfs/%.c=src/imfs/$(ARCH)/%.$(OBJEXT))
     39
     40EXTRA_LIBRARIES = o-optimize/libimfs.a
     41o_optimize_libimfs_a_SOURCES = $(libimfs_C_FILES)
     42o_optimize_libimfs_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_OPTIMIZE_V)
     43
     44EXTRA_LIBRARIES += o-debug/libimfs.a
     45o_debug_libimfs_a_SOURCES = $(libimfs_C_FILES)
     46o_debug_libimfs_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_DEBUG_V)
    4247
    4348include_HEADERS += src/imfs/imfs.h
    4449
    45 IMFSLIB = src/imfs/$(ARCH)/libimfs.a
    46 
    47 src/imfs/$(ARCH)/$(dirstamp):
    48         @$(mkdir_p) src/imfs/$(ARCH)
    49         @: > src/imfs/$(ARCH)/$(dirstamp)
    50 src/imfs/$(ARCH)/%.$(OBJEXT): src/imfs/%.c src/imfs/$(ARCH)/$(dirstamp)
    51         ${COMPILE} -o $@ -c $<
    52 src/imfs/$(ARCH)/libimfs.a: ${libimfs_OBJS}
    53         $(make-library)
    54 
    55 EXTRA_DIST += $(libimfs_EMBEDDED_C_FILES) $(libimfs_UNIX_C_FILES)
     50IMFSLIB = $(ARCH)/libimfs.a
    5651
    5752# dosfs
     
    7267if !UNIX
    7368libdosfs_C_FILES = $(libdosfs_FATFS_C_FILES) $(libdosfs_DOSFS_C_FILES)
    74 libdosfs_OBJS = \
    75     $(libdosfs_C_FILES:src/dosfs/%.c=src/dosfs/${ARCH}/%.$(OBJEXT))
    7669
    7770include_HEADERS += src/dosfs/dosfs.h
    7871
    79 DOSFSLIB = src/dosfs/$(ARCH)/libdosfs.a
     72DOSFSLIB = $(ARCH)/libdosfs.a
    8073
    81 src/dosfs/$(ARCH)/$(dirstamp):
    82         @$(mkdir_p) src/dosfs/$(ARCH)
    83         @: > src/dosfs/$(ARCH)/$(dirstamp)
    84 src/dosfs/$(ARCH)/%.$(OBJEXT): src/dosfs/%.c src/dosfs/$(ARCH)/$(dirstamp)
    85         ${COMPILE} -o $@ -c $<
    86 src/dosfs/$(ARCH)/libdosfs.a: ${libdosfs_OBJS}
    87         $(make-library)
     74EXTRA_LIBRARIES += o-optimize/libdosfs.a
     75o_optimize_libdosfs_a_SOURCES = $(libdosfs_C_FILES)
     76o_optimize_libdosfs_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_OPTIMIZE_V)
     77
     78EXTRA_LIBRARIES += o-debug/libdosfs.a
     79o_debug_libdosfs_a_SOURCES = $(libdosfs_C_FILES)
     80o_debug_libdosfs_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_DEBUG_V)
     81
    8882endif
    8983
    90 all-local: $(IMFSLIB) $(DOSFSLIB)
    91 
    92 EXTRA_DIST += $(libdosfs_DOSFS_C_FILES) $(libdosfs_FATFS_C_FILES)
    93 
    94 CLEANDIRS = src
     84all-local: $(PREINSTALL_FILES) $(IMFSLIB) $(DOSFSLIB)
    9585
    9686# ---
  • cpukit/libmisc/ChangeLog

    re7d110ba r07347cb  
     12004-01-07  Ralf Corsepius <corsepiu@faw.uni-ulm.de>
     2
     3        * Makefile.am: Build library using EXTRA_LIBRARIES and automake rules.
     4
    152003-12-12      Ralf Corsepius <corsepiu@faw.uni-ulm.de>
    26
  • cpukit/libmisc/Makefile.am

    re7d110ba r07347cb  
    33##
    44
    5 include $(top_srcdir)/automake/compile.am
    6 include $(top_srcdir)/automake/lib.am
     5include $(top_srcdir)/automake/amcompile.am
    76
    87EXTRA_DIST = README
     
    1312include_HEADERS =
    1413include_rtems_HEADERS =
    15 noinst_HEADERS =
     14EXTRA_LIBRARIES =
     15TMP_LIBS =
    1616
    1717## capture
    1818
    1919libcapture_C_FILES = capture/capture.c capture/capture-cli.c
    20 libcapture_OBJS = \
    21     $(libcapture_C_FILES:capture/%.c=capture/$(ARCH)/%.$(OBJEXT))
    22 
    2320include_rtems_HEADERS += capture/capture.h capture/capture-cli.h
    2421
    25 capture/$(ARCH)/$(dirstamp):
    26         @$(mkdir_p) capture/$(ARCH)
    27         @: > capture/$(ARCH)/$(dirstamp)
    28 capture/$(ARCH)/%.$(OBJEXT): capture/%.c capture/$(ARCH)/$(dirstamp)
    29         ${COMPILE} -o $@ -c $<
    30 capture/$(ARCH)/libcapture.a: $(libcapture_OBJS)
    31         $(make-library)
    32 
    33 LIBS += capture/$(ARCH)/libcapture.a
    34 
    35 EXTRA_DIST += capture/README capture/capture.c capture/capture-cli.c
     22EXTRA_LIBRARIES += o-optimize/libcapture.a
     23o_optimize_libcapture_a_SOURCES = $(libcapture_C_FILES)
     24o_optimize_libcapture_a_CPPFLAGS = $(AM_CPPFLAGS) \
     25    $(CFLAGS_OPTIMIZE_V)
     26
     27EXTRA_LIBRARIES += o-debug/libcapture.a
     28o_debug_libcapture_a_SOURCES = $(libcapture_C_FILES)
     29o_debug_libcapture_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_DEBUG_V)
     30
     31TMP_LIBS += $(ARCH)/libcapture.a
    3632
    3733## cpuuse
    3834
    3935libcpuuse_C_FILES = cpuuse/cpuuse.c
    40 libcpuuse_OBJS = $(libcpuuse_C_FILES:cpuuse/%.c=cpuuse/$(ARCH)/%.$(OBJEXT))
    41 
    4236include_rtems_HEADERS += cpuuse/cpuuse.h
    4337
    44 cpuuse/$(ARCH)/$(dirstamp):
    45         @$(mkdir_p) cpuuse/$(ARCH)
    46         @: > cpuuse/$(ARCH)/$(dirstamp)
    47 cpuuse/$(ARCH)/%.$(OBJEXT): cpuuse/%.c cpuuse/$(ARCH)/$(dirstamp)
    48         ${COMPILE} -o $@ -c $<
    49 cpuuse/$(ARCH)/libcpuuse.a: $(libcpuuse_OBJS)
    50         $(make-library)
    51 
    52 LIBS += cpuuse/$(ARCH)/libcpuuse.a
    53 EXTRA_DIST += cpuuse/README cpuuse/cpuuse.c
     38EXTRA_LIBRARIES += o-optimize/libcpuuse.a
     39o_optimize_libcpuuse_a_SOURCES = $(libcpuuse_C_FILES)
     40o_optimize_libcpuuse_a_CPPFLAGS = $(AM_CPPFLAGS) \
     41    $(CFLAGS_OPTIMIZE_V)
     42
     43EXTRA_LIBRARIES += o-debug/libcpuuse.a
     44o_debug_libcpuuse_a_SOURCES = $(libcpuuse_C_FILES)
     45o_debug_libcpuuse_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_DEBUG_V)
     46
     47TMP_LIBS += $(ARCH)/libcpuuse.a
    5448
    5549## devnull
    5650
    5751libdevnull_C_FILES = devnull/devnull.c
    58 libdevnull_OBJS = \
    59     $(libdevnull_C_FILES:devnull/%.c=devnull/$(ARCH)/%.$(OBJEXT))
    60 
    6152include_rtems_HEADERS += devnull/devnull.h
    6253
    63 devnull/$(ARCH)/$(dirstamp):
    64         @$(mkdir_p) devnull/$(ARCH)
    65         @: > devnull/$(ARCH)/$(dirstamp)
    66 devnull/$(ARCH)/%.$(OBJEXT): devnull/%.c devnull/$(ARCH)/$(dirstamp)
    67         ${COMPILE} -o $@ -c $<
    68 devnull/$(ARCH)/libdevnull.a: $(libdevnull_OBJS)
    69         $(make-library)
    70 
    71 LIBS += devnull/$(ARCH)/libdevnull.a
    72 
    73 EXTRA_DIST += devnull/devnull.c
     54EXTRA_LIBRARIES += o-optimize/libdevnull.a
     55o_optimize_libdevnull_a_SOURCES = $(libdevnull_C_FILES)
     56o_optimize_libdevnull_a_CPPFLAGS = $(AM_CPPFLAGS) \
     57    $(CFLAGS_OPTIMIZE_V)
     58
     59EXTRA_LIBRARIES += o-debug/libdevnull.a
     60o_debug_libdevnull_a_SOURCES = $(libdevnull_C_FILES)
     61o_debug_libdevnull_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_DEBUG_V)
     62
     63TMP_LIBS += $(ARCH)/libdevnull.a
    7464
    7565## dummy
    7666
    7767libdummy_C_FILES = dummy/dummy.c
    78 libdummy_OBJS = $(libdummy_C_FILES:dummy/%.c=dummy/$(ARCH)/%.$(OBJEXT))
    79 
    80 dummy/$(ARCH)/$(dirstamp):
    81         @$(mkdir_p) dummy/$(ARCH)
    82         @: > dummy/$(ARCH)/$(dirstamp)
    83 dummy/$(ARCH)/%.$(OBJEXT): dummy/%.c dummy/$(ARCH)/$(dirstamp)
    84         ${COMPILE} -o $@ -c $<
    85 dummy/$(ARCH)/libdummy.a: $(libdummy_OBJS)
    86         $(make-library)
    87 
    88 LIBS += dummy/$(ARCH)/libdummy.a
    89 
    90 EXTRA_DIST += dummy/README dummy/dummy.c
     68EXTRA_DIST += dummy/README
     69
     70EXTRA_LIBRARIES += o-optimize/libdummy.a
     71o_optimize_libdummy_a_SOURCES = $(libdummy_C_FILES)
     72o_optimize_libdummy_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_OPTIMIZE_V)
     73
     74EXTRA_LIBRARIES += o-debug/libdummy.a
     75o_debug_libdummy_a_SOURCES = $(libdummy_C_FILES)
     76o_debug_libdummy_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_DEBUG_V)
     77
     78TMP_LIBS += $(ARCH)/libdummy.a
    9179
    9280## dumpbuf
    9381
    9482libdumpbuf_C_FILES = dumpbuf/dumpbuf.c
    95 libdumpbuf_OBJS = \
    96     $(libdumpbuf_C_FILES:dumpbuf/%.c=dumpbuf/$(ARCH)/%.$(OBJEXT))
    97 
    9883include_rtems_HEADERS += dumpbuf/dumpbuf.h
    9984
    100 dumpbuf/$(ARCH)/$(dirstamp):
    101         @$(mkdir_p) dumpbuf/$(ARCH)
    102         @: > dumpbuf/$(ARCH)/$(dirstamp)
    103 dumpbuf/$(ARCH)/%.$(OBJEXT): dumpbuf/%.c dumpbuf/$(ARCH)/$(dirstamp)
    104         ${COMPILE} -o $@ -c $<
    105 dumpbuf/$(ARCH)/libdumpbuf.a: $(libdumpbuf_OBJS)
    106         $(make-library)
    107 
    108 LIBS += dumpbuf/$(ARCH)/libdumpbuf.a
    109 
    110 EXTRA_DIST += dumpbuf/dumpbuf.c
     85EXTRA_LIBRARIES += o-optimize/libdumpbuf.a
     86o_optimize_libdumpbuf_a_SOURCES = $(libdumpbuf_C_FILES)
     87o_optimize_libdumpbuf_a_CPPFLAGS = $(AM_CPPFLAGS) \
     88    $(CFLAGS_OPTIMIZE_V)
     89
     90EXTRA_LIBRARIES += o-debug/libdumpbuf.a
     91o_debug_libdumpbuf_a_SOURCES = $(libdumpbuf_C_FILES)
     92o_debug_libdumpbuf_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_DEBUG_V)
     93
     94TMP_LIBS += $(ARCH)/libdumpbuf.a
    11195
    11296## monitor
    11397
    114 # We only build multiprocessing related files if HAS_MP was defined
    115 libmonitor_MP_C_FILES = monitor/mon-mpci.c
     98include_rtems_HEADERS += monitor/monitor.h
    11699
    117100libmonitor_C_FILES = monitor/mon-command.c monitor/mon-symbols.c \
     
    119102    monitor/mon-server.c monitor/mon-task.c monitor/mon-queue.c \
    120103    monitor/mon-driver.c monitor/mon-dname.c monitor/mon-itask.c \
    121     monitor/mon-extension.c monitor/mon-manager.c monitor/mon-config.c
    122 
    123 libmonitor_OBJS = \
    124     $(libmonitor_C_FILES:monitor/%.c=monitor/$(ARCH)/%.$(OBJEXT))
     104    monitor/mon-extension.c monitor/mon-manager.c monitor/mon-config.c \
     105    monitor/symbols.h
    125106if HAS_MP
    126 libmonitor_OBJS += \
    127     $(libmonitor_MP_C_FILES:monitor/%.c=monitor/$(ARCH)/%.$(OBJEXT))
    128 endif
    129 
    130 include_rtems_HEADERS += monitor/monitor.h
    131 
    132 noinst_HEADERS += monitor/symbols.h
    133 
    134 monitor/$(ARCH)/$(dirstamp):
    135         @$(mkdir_p) monitor/$(ARCH)
    136         @: > monitor/$(ARCH)/$(dirstamp)
    137 monitor/$(ARCH)/%.$(OBJEXT): monitor/%.c monitor/$(ARCH)/$(dirstamp)
    138         ${COMPILE} -o $@ -c $<
    139 monitor/$(ARCH)/libmonitor.a: $(libmonitor_OBJS)
    140         $(make-library)
    141 
    142 LIBS += monitor/$(ARCH)/libmonitor.a
    143 
    144 EXTRA_DIST += monitor/README monitor/mon-command.c monitor/mon-config.c \
    145     monitor/mon-dname.c monitor/mon-driver.c monitor/mon-extension.c \
    146     monitor/mon-itask.c monitor/mon-manager.c monitor/mon-monitor.c \
    147     monitor/mon-mpci.c monitor/mon-object.c monitor/mon-prmisc.c \
    148     monitor/mon-queue.c monitor/mon-server.c monitor/mon-symbols.c \
    149     monitor/mon-task.c
     107libmonitor_C_FILES += monitor/mon-mpci.c
     108endif
     109
     110EXTRA_LIBRARIES += o-optimize/libmonitor.a
     111o_optimize_libmonitor_a_SOURCES = $(libmonitor_C_FILES)
     112o_optimize_libmonitor_a_CPPFLAGS = $(AM_CPPFLAGS) \
     113    $(CFLAGS_OPTIMIZE_V)
     114
     115EXTRA_LIBRARIES += o-debug/libmonitor.a
     116o_debug_libmonitor_a_SOURCES = $(libmonitor_C_FILES)
     117o_debug_libmonitor_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_DEBUG_V)
     118
     119EXTRA_DIST += monitor/README
     120
     121TMP_LIBS += $(ARCH)/libmonitor.a
    150122
    151123## mw-fb
    152124
    153125libmw_fb_C_FILES = mw-fb/mw_fb.c mw-fb/mw_uid.c
    154 libmw_fb_OBJS = $(libmw_fb_C_FILES:mw-fb/%.c=mw-fb/${ARCH}/%.$(OBJEXT))
    155 
    156126include_rtems_HEADERS += mw-fb/mw_fb.h mw-fb/mw_uid.h
    157127
    158 mw-fb/$(ARCH)/$(dirstamp):
    159         @$(mkdir_p) mw-fb/$(ARCH)
    160         @: > mw-fb/$(ARCH)/$(dirstamp)
    161 mw-fb/$(ARCH)/%.$(OBJEXT): mw-fb/%.c mw-fb/$(ARCH)/$(dirstamp)
    162         ${COMPILE} -o $@ -c $<
    163 mw-fb/$(ARCH)/libmw-fb.a: $(libmw_fb_OBJS)
    164         $(make-library)
    165 
    166 LIBS += mw-fb/$(ARCH)/libmw-fb.a
    167 
    168 EXTRA_DIST += $(libmw_fb_C_FILES)
     128EXTRA_LIBRARIES += o-optimize/libmw-fb.a
     129o_optimize_libmw_fb_a_SOURCES = $(libmw_fb_C_FILES)
     130o_optimize_libmw_fb_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_OPTIMIZE_V)
     131
     132EXTRA_LIBRARIES += o-debug/libmw-fb.a
     133o_debug_libmw_fb_a_SOURCES = $(libmw_fb_C_FILES)
     134o_debug_libmw_fb_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_DEBUG_V)
     135
     136TMP_LIBS += $(ARCH)/libmw-fb.a
    169137
    170138## shell
    171 
    172 libshell_C_FILES = shell/cmds.c shell/shell.c
    173 libshell_OBJS = $(libshell_C_FILES:shell/%.c=shell/$(ARCH)/%.$(OBJEXT))
    174139
    175140if LIBSHELL
    176141include_rtems_HEADERS += shell/shell.h
    177 endif
    178 
    179 shell/$(ARCH)/$(dirstamp):
    180         @$(mkdir_p) shell/$(ARCH)
    181         @: > shell/$(ARCH)/$(dirstamp)
    182 shell/$(ARCH)/%.$(OBJEXT): shell/%.c shell/$(ARCH)/$(dirstamp)
    183         ${COMPILE} -o $@ -c $<
    184 shell/$(ARCH)/libshell.a: $(libshell_OBJS)
    185         $(make-library)
    186 
    187 if LIBSHELL
    188 LIBS += shell/$(ARCH)/libshell.a
    189 endif
    190 
    191 EXTRA_DIST += shell/README shell/shell.c shell/cmds.c
     142libshell_C_FILES = shell/cmds.c shell/shell.c
     143
     144EXTRA_LIBRARIES += o-optimize/libshell.a
     145o_optimize_libshell_a_SOURCES = $(libshell_C_FILES)
     146o_optimize_libshell_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_OPTIMIZE_V)
     147
     148EXTRA_LIBRARIES += o-debug/libshell.a
     149o_debug_libshell_a_SOURCES = $(libshell_C_FILES)
     150o_debug_libshell_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_DEBUG_V)
     151
     152TMP_LIBS += $(ARCH)/libshell.a
     153endif
     154
     155EXTRA_DIST += shell/README
    192156
    193157## rtmonuse
    194158
    195159librtmonuse_C_FILES = rtmonuse/rtmonuse.c
    196 librtmonuse_OBJS = \
    197     $(librtmonuse_C_FILES:rtmonuse/%.c=rtmonuse/$(ARCH)/%.$(OBJEXT))
    198 
    199160include_rtems_HEADERS += rtmonuse/rtmonuse.h
    200161
    201 rtmonuse/$(ARCH)/$(dirstamp):
    202         @$(mkdir_p) rtmonuse/$(ARCH)
    203         @: > rtmonuse/$(ARCH)/$(dirstamp)
    204 rtmonuse/$(ARCH)/%.$(OBJEXT): rtmonuse/%.c rtmonuse/$(ARCH)/$(dirstamp)
    205         ${COMPILE} -o $@ -c $<
    206 rtmonuse/$(ARCH)/librtmonuse.a: $(librtmonuse_OBJS)
    207         $(make-library)
    208 
    209 LIBS += rtmonuse/$(ARCH)/librtmonuse.a
    210 
    211 EXTRA_DIST += rtmonuse/rtmonuse.c
     162EXTRA_LIBRARIES += o-optimize/librtmonuse.a
     163o_optimize_librtmonuse_a_SOURCES = $(librtmonuse_C_FILES)
     164o_optimize_librtmonuse_a_CPPFLAGS = $(AM_CPPFLAGS) \
     165    $(CFLAGS_OPTIMIZE_V)
     166
     167EXTRA_LIBRARIES += o-debug/librtmonuse.a
     168o_debug_librtmonuse_a_SOURCES = $(librtmonuse_C_FILES)
     169o_debug_librtmonuse_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_DEBUG_V)
     170
     171TMP_LIBS += $(ARCH)/librtmonuse.a
    212172
    213173## serdbg
    214 
    215 libserdbg_C_FILES = serdbg/serdbg.c serdbg/serdbgio.c \
    216     serdbg/termios_printk.c
    217 libserdbg_OBJS = $(libserdbg_C_FILES:serdbg/%.c=serdbg/$(ARCH)/%.$(OBJEXT))
    218174
    219175if LIBSERDBG
    220176include_HEADERS += serdbg/serdbgcnf.h serdbg/serdbg.h \
    221177    serdbg/termios_printk_cnf.h serdbg/termios_printk.h
    222 endif
    223 
    224 serdbg/$(ARCH)/$(dirstamp):
    225         @$(mkdir_p) serdbg/$(ARCH)
    226         @: > serdbg/$(ARCH)/$(dirstamp)
    227 serdbg/$(ARCH)/%.$(OBJEXT): serdbg/%.c serdbg/$(ARCH)/$(dirstamp)
    228         ${COMPILE} -o $@ -c $<
    229 serdbg/$(ARCH)/libserdbg.a: $(libserdbg_OBJS)
    230         $(make-library)
    231 
    232 if LIBSERDBG
    233 LIBS += serdbg/$(ARCH)/libserdbg.a
    234 endif
    235 
    236 EXTRA_DIST += serdbg/README serdbg/serdbg.c serdbg/serdbgio.c \
    237     serdbg/serdbgcnf.h serdbg/serdbg.h serdbg/termios_printk.c \
    238     serdbg/termios_printk.h serdbg/termios_printk_cnf.h
     178
     179libserdbg_C_FILES = serdbg/serdbg.c serdbg/serdbgio.c \
     180    serdbg/termios_printk.c
     181
     182EXTRA_LIBRARIES += o-optimize/libserdbg.a
     183o_optimize_libserdbg_a_SOURCES = $(libserdbg_C_FILES)
     184o_optimize_libserdbg_a_CPPFLAGS = $(AM_CPPFLAGS) \
     185    $(CFLAGS_OPTIMIZE_V)
     186
     187EXTRA_LIBRARIES += o-debug/libserdbg.a
     188o_debug_libserdbg_a_SOURCES = $(libserdbg_C_FILES)
     189o_debug_libserdbg_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_DEBUG_V)
     190
     191TMP_LIBS += $(ARCH)/libserdbg.a
     192endif
     193
     194EXTRA_DIST += serdbg/README
    239195
    240196## stackchk
    241197
    242 libstackchk_C_FILES = stackchk/check.c
    243 libstackchk_OBJS = \
    244     $(libstackchk_C_FILES:stackchk/%.c=stackchk/$(ARCH)/%.$(OBJEXT))
    245 
    246198include_rtems_HEADERS += stackchk/stackchk.h
    247 
    248 noinst_HEADERS += stackchk/internal.h
    249 
    250 stackchk/$(ARCH)/$(dirstamp):
    251         @$(mkdir_p) stackchk/$(ARCH)
    252         @: > stackchk/$(ARCH)/$(dirstamp)
    253 stackchk/$(ARCH)/%.$(OBJEXT): stackchk/%.c stackchk/$(ARCH)/$(dirstamp)
    254         ${COMPILE} -o $@ -c $<
    255 stackchk/$(ARCH)/libstackchk.a: $(libstackchk_OBJS)
    256         $(make-library)
    257 
    258 LIBS += stackchk/$(ARCH)/libstackchk.a
    259 
    260 EXTRA_DIST += stackchk/README stackchk/check.c
     199libstackchk_C_FILES = stackchk/check.c stackchk/internal.h
     200
     201EXTRA_LIBRARIES += o-optimize/libstackchk.a
     202o_optimize_libstackchk_a_SOURCES = $(libstackchk_C_FILES)
     203o_optimize_libstackchk_a_CPPFLAGS = $(AM_CPPFLAGS) \
     204    $(CFLAGS_OPTIMIZE_V)
     205
     206EXTRA_LIBRARIES += o-debug/libstackchk.a
     207o_debug_libstackchk_a_SOURCES = $(libstackchk_C_FILES)
     208o_debug_libstackchk_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_DEBUG_V)
     209
     210TMP_LIBS += $(ARCH)/libstackchk.a
     211EXTRA_DIST += stackchk/README
    261212
    262213## libuntar
    263214
     215include_rtems_HEADERS += untar/untar.h
    264216libuntar_C_FILES = untar/untar.c
    265 libuntar_OBJS = $(libuntar_C_FILES:untar/%.c=untar/$(ARCH)/%.$(OBJEXT))
    266 
    267 include_rtems_HEADERS += untar/untar.h
    268 
    269 untar/$(ARCH)/$(dirstamp):
    270         @$(mkdir_p) untar/$(ARCH)
    271         @: > untar/$(ARCH)/$(dirstamp)
    272 untar/$(ARCH)/%.$(OBJEXT): untar/%.c untar/$(ARCH)/$(dirstamp)
    273         ${COMPILE} -o $@ -c $<
    274 untar/$(ARCH)/libuntar.a: $(libuntar_OBJS)
    275         $(make-library)
    276 
    277 LIBS += untar/$(ARCH)/libuntar.a
    278 
    279 EXTRA_DIST += untar/README untar/untar.c
     217
     218EXTRA_LIBRARIES += o-optimize/libuntar.a
     219o_optimize_libuntar_a_SOURCES = $(libuntar_C_FILES)
     220o_optimize_libuntar_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_OPTIMIZE_V)
     221
     222EXTRA_LIBRARIES += o-debug/libuntar.a
     223o_debug_libuntar_a_SOURCES = $(libuntar_C_FILES)
     224o_debug_libuntar_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_DEBUG_V)
     225
     226TMP_LIBS += $(ARCH)/libuntar.a
     227
     228EXTRA_DIST += untar/README
    280229
    281230## fsmount
    282231
    283232libfsmount_C_FILES = fsmount/fsmount.c
    284 libfsmount_OBJS = \
    285     $(libfsmount_C_FILES:fsmount/%.c=fsmount/$(ARCH)/%.$(OBJEXT))
    286 
    287233include_rtems_HEADERS += fsmount/fsmount.h
    288234
    289 fsmount/$(ARCH)/$(dirstamp):
    290         @$(mkdir_p) fsmount/$(ARCH)
    291         @: > fsmount/$(ARCH)/$(dirstamp)
    292 fsmount/$(ARCH)/%.$(OBJEXT): fsmount/%.c fsmount/$(ARCH)/$(dirstamp)
    293         ${COMPILE} -o $@ -c $<
    294 fsmount/$(ARCH)/libfsmount.a: $(libfsmount_OBJS)
    295         $(make-library)
    296 
    297 LIBS += fsmount/$(ARCH)/libfsmount.a
    298 
    299 EXTRA_DIST += fsmount/README fsmount/fsmount.c
     235EXTRA_LIBRARIES += o-optimize/libfsmount.a
     236o_optimize_libfsmount_a_SOURCES = $(libfsmount_C_FILES)
     237o_optimize_libfsmount_a_CPPFLAGS = $(AM_CPPFLAGS) \
     238    $(CFLAGS_OPTIMIZE_V)
     239
     240EXTRA_LIBRARIES += o-debug/libfsmount.a
     241o_debug_libfsmount_a_SOURCES = $(libfsmount_C_FILES)
     242o_debug_libfsmount_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_DEBUG_V)
     243
     244TMP_LIBS += $(ARCH)/libfsmount.a
     245
     246EXTRA_DIST += fsmount/README
    300247
    301248## ---
    302249
    303 all-local: $(LIBS)
    304 .PRECIOUS: $(LIBS)
    305 
    306 CLEANDIRS = */$(ARCH)
     250all-local: $(PREINSTALL_FILES) $(TMP_LIBS)
    307251
    308252PREINSTALL_FILES =
  • cpukit/libnetworking/ChangeLog

    re7d110ba r07347cb  
     12004-01-07  Ralf Corsepius <corsepiu@faw.uni-ulm.de>
     2
     3        * Makefile.am: Build library using EXTRA_LIBRARIES and automake rules.
     4
    152003-12-12      Ralf Corsepius <corsepiu@faw.uni-ulm.de>
    26
  • cpukit/libnetworking/Makefile.am

    re7d110ba r07347cb  
    66
    77include $(top_srcdir)/automake/multilib.am
    8 include $(top_srcdir)/automake/compile.am
    9 include $(top_srcdir)/automake/lib.am
     8include $(top_srcdir)/automake/amcompile.am
    109
    1110AM_CPPFLAGS += -I$(top_builddir)
    1211
    1312if HAS_NETWORKING
     13
    1414# Add -DFORWARD_PROTOCOL to enable UDP forwarding -- requires missing net/pf.h
    1515libnetworking_CPPFLAGS = -D_COMPILING_BSD_KERNEL_ -DKERNEL -DINET -DNFS \
    1616    -DDIAGNOSTIC -DBOOTP_COMPAT
     17
     18EXTRA_LIBRARIES = o-optimize/libnetworking.a
     19o_optimize_libnetworking_a_SOURCES =
     20o_optimize_libnetworking_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_OPTIMIZE_V) \
     21$(libnetworking_CPPFLAGS)
     22
     23EXTRA_LIBRARIES += o-debug/libnetworking.a
     24o_debug_libnetworking_a_SOURCES =
     25o_debug_libnetworking_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_DEBUG_V) \
     26$(libnetworking_CPPFLAGS)
    1727
    1828TMP_LIBS = $(ARCH)/libnetworking.a
     
    3545    kern/uipc_domain.c kern/uipc_mbuf.c kern/uipc_socket.c \
    3646    kern/uipc_socket2.c
    37 libnetworking_OBJS = $(kern_C_FILES:kern/%.c=$(ARCH)/%.$(OBJEXT))
    38 
    39 $(ARCH)/%.$(OBJEXT): kern/%.c $(ARCH)/$(dirstamp)
    40         ${COMPILE} $(libnetworking_CPPFLAGS) -o $@ -c $<
    41 
    42 EXTRA_DIST = $(kern_C_FILES)
     47o_optimize_libnetworking_a_SOURCES += $(kern_C_FILES)
     48o_debug_libnetworking_a_SOURCES += $(kern_C_FILES)
    4349
    4450## machine
     
    6167    net/route.c net/rtsock.c net/raw_cb.c net/raw_usrreq.c net/if_ppp.c \
    6268    net/ppp_tty.c net/pppcompress.c
    63 libnetworking_OBJS += $(net_C_FILES:net/%.c=$(ARCH)/%.$(OBJEXT))
    64 
    65 $(ARCH)/%.$(OBJEXT): net/%.c $(ARCH)/$(dirstamp)
    66         ${COMPILE} $(libnetworking_CPPFLAGS) -o $@ -c $<
    67 
    68 EXTRA_DIST += $(net_C_FILES)
     69o_optimize_libnetworking_a_SOURCES += $(net_C_FILES)
     70o_debug_libnetworking_a_SOURCES += $(net_C_FILES)
    6971
    7072## netinet
     
    8789    netinet/tcp_subr.c netinet/tcp_timer.c netinet/tcp_usrreq.c \
    8890    netinet/udp_usrreq.c
    89 libnetworking_OBJS += $(netinet_C_FILES:netinet/%.c=$(ARCH)/%.$(OBJEXT))
    90 
    91 $(ARCH)/%.$(OBJEXT): netinet/%.c $(ARCH)/$(dirstamp)
    92         ${COMPILE} $(libnetworking_CPPFLAGS) -o $@ -c $<
    93 
    94 EXTRA_DIST += $(netinet_C_FILES)
     91o_optimize_libnetworking_a_SOURCES += $(netinet_C_FILES)
     92o_debug_libnetworking_a_SOURCES += $(netinet_C_FILES)
    9593
    9694## nfs
     
    102100
    103101nfs_C_FILES = nfs/bootp_subr.c
    104 libnetworking_OBJS += $(nfs_C_FILES:nfs/%.c=$(ARCH)/%.$(OBJEXT))
    105 
    106 $(ARCH)/%.$(OBJEXT): nfs/%.c $(ARCH)/$(dirstamp)
    107         ${COMPILE} $(libnetworking_CPPFLAGS) -o $@ -c $<
    108 
    109 EXTRA_DIST += $(nfs_C_FILES)
     102o_optimize_libnetworking_a_SOURCES += $(nfs_C_FILES)
     103o_debug_libnetworking_a_SOURCES += $(nfs_C_FILES)
    110104
    111105## rtems
     
    122116    rtems/rtems_showtcpstat.c rtems/rtems_showudpstat.c rtems/rtems_select.c \
    123117    rtems/mkrootfs.c rtems/rtems_bsdnet_malloc_starvation.c
    124 libnetworking_OBJS += $(rtems_C_FILES:rtems/%.c=$(ARCH)/%.$(OBJEXT))
    125 
    126 $(ARCH)/%.$(OBJEXT): rtems/%.c $(ARCH)/$(dirstamp)
    127         ${COMPILE} $(libnetworking_CPPFLAGS) -o $@ -c $<
    128 
    129 EXTRA_DIST += $(rtems_C_FILES)
     118o_optimize_libnetworking_a_SOURCES += $(rtems_C_FILES)
     119o_debug_libnetworking_a_SOURCES += $(rtems_C_FILES)
    130120
    131121## sys
     
    147137
    148138## libc
     139
     140libc_CPPFLAGS = -DNOPOLL -DNOSELECT
     141
     142EXTRA_LIBRARIES += o-optimize/libc.a
     143o_optimize_libc_a_SOURCES =
     144o_optimize_libc_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_OPTIMIZE_V) \
     145$(libc_CPPFLAGS)
     146
     147EXTRA_LIBRARIES += o-debug/libc.a
     148o_debug_libc_a_SOURCES =
     149o_debug_libc_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_DEBUG_V) \
     150$(libc_CPPFLAGS)
    149151
    150152libc_C_FILES = libc/addr2ascii.c libc/ascii2addr.c libc/base64.c \
     
    161163    libc/res_mkquery.c libc/res_mkupdate.c libc/res_query.c libc/res_send.c \
    162164    libc/res_stubs.c libc/res_update.c libc/strsep.c libc/rcmd.c
    163 libc_OBJS = $(libc_C_FILES:libc/%.c=libc/$(ARCH)/%.$(OBJEXT))
     165o_optimize_libc_a_SOURCES += $(libc_C_FILES)
     166o_debug_libc_a_SOURCES += $(libc_C_FILES)
    164167
    165168man_MANS = libc/addr2ascii.3 libc/byteorder.3 libc/ethers.3 \
     
    168171    libc/rcmd.3 libc/resolver.3
    169172
    170 libc_CPPFLAGS = -DNOPOLL -DNOSELECT
    171 
    172 libc/$(ARCH)/$(dirstamp):
    173         @$(mkdir_p) libc/$(ARCH)
    174         @: > libc/$(ARCH)/$(dirstamp)
    175 libc/$(ARCH)/%.$(OBJEXT): libc/%.c libc/$(ARCH)/$(dirstamp)
    176         ${COMPILE} $(libc_CPPFLAGS) -o $@ -c $<
    177 libc/$(ARCH)/lib.a: $(libc_OBJS)
    178         $(make-library)
    179 
    180 TMP_LIBS += libc/$(ARCH)/lib.a
    181 
    182 CLEANDIRS = libc/o-optimize libc/o-debug
    183 
    184 EXTRA_DIST += libc/addr2ascii.3 libc/addr2ascii.c libc/ascii2addr.c \
     173TMP_LIBS += $(ARCH)/libc.a
     174
     175EXTRA_DIST = libc/addr2ascii.3 libc/addr2ascii.c libc/ascii2addr.c \
    185176    libc/base64.c libc/byteorder.3 libc/ether_addr.c libc/ethers.3 \
    186177    libc/gethostbydns.c libc/gethostbyht.c libc/gethostbyname.3 \
     
    203194## lib
    204195
     196lib_CPPFLAGS = -DNOPOLL -DNOSELECT
     197
     198EXTRA_LIBRARIES += o-optimize/lib.a
     199o_optimize_lib_a_SOURCES =
     200o_optimize_lib_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_OPTIMIZE_V) \
     201$(lib_CPPFLAGS)
     202
     203EXTRA_LIBRARIES += o-debug/lib.a
     204o_debug_lib_a_SOURCES =
     205o_debug_lib_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_DEBUG_V) \
     206$(lib_CPPFLAGS)
     207
    205208lib_C_FILES = lib/getprotoby.c lib/rtems_bsdnet_ntp.c lib/ftpfs.c \
    206209    lib/syslog.c lib/tftpDriver.c
    207 lib_OBJS = $(lib_C_FILES:lib/%.c=lib/$(ARCH)/%.$(OBJEXT))
    208 
    209 lib_CPPFLAGS = -DNOPOLL -DNOSELECT
    210 
    211 lib/$(ARCH)/$(dirstamp):
    212         @$(mkdir_p) lib/$(ARCH)
    213         @: > lib/$(ARCH)/$(dirstamp)
    214 lib/$(ARCH)/%.$(OBJEXT): lib/%.c lib/$(ARCH)/$(dirstamp)
    215         ${COMPILE} $(lib_CPPFLAGS) -o $@ -c $<
    216 lib/$(ARCH)/lib.a: $(lib_OBJS)
    217         $(make-library)
    218 
    219 TMP_LIBS += lib/$(ARCH)/lib.a
    220 
    221 CLEANDIRS += lib/o-optimize lib/o-debug
    222 
    223 EXTRA_DIST += lib/README lib/getprotoby.c lib/rtems_bsdnet_ntp.c \
    224     lib/syslog.c lib/tftpDriver.c
     210o_optimize_lib_a_SOURCES += $(lib_C_FILES)
     211o_debug_lib_a_SOURCES += $(lib_C_FILES)
     212
     213TMP_LIBS += $(ARCH)/lib.a
    225214
    226215# ---
    227 
    228 $(ARCH)/libnetworking.a: $(libnetworking_OBJS)
    229         $(make-library)
    230 
    231216all-local: $(PREINSTALL_FILES) $(TMP_LIBS)
    232217endif
  • cpukit/librpc/ChangeLog

    re7d110ba r07347cb  
     12004-01-07  Ralf Corsepius <corsepiu@faw.uni-ulm.de>
     2
     3        * Makefile.am: Build library using EXTRA_LIBRARIES and automake rules.
     4
    152003-12-12      Ralf Corsepius <corsepiu@faw.uni-ulm.de>
    26
  • cpukit/librpc/Makefile.am

    re7d110ba r07347cb  
    44
    55include $(top_srcdir)/automake/multilib.am
    6 include $(top_srcdir)/automake/compile.am
    7 include $(top_srcdir)/automake/lib.am
     6include $(top_srcdir)/automake/amcompile.am
    87
    98if LIBRPC
     
    2322    src/xdr/xdr_sizeof.c src/xdr/xdr_stdio.c
    2423
    25 CLEANDIRS = src/xdr
     24if LIBRPC
     25EXTRA_LIBRARIES = o-optimize/libxdr.a
     26o_optimize_libxdr_a_SOURCES = $(libxdr_C_FILES)
     27o_optimize_libxdr_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_OPTIMIZE_V)
    2628
    27 EXTRA_DIST = $(libxdr_C_FILES)
    28 
    29 if LIBRPC
    30 libxdr_C_O_FILES = \
    31     $(libxdr_C_FILES:src/xdr/%.c=src/xdr/$(ARCH)/%.$(OBJEXT))
    32 
    33 libxdr_OBJS = $(libxdr_C_O_FILES)
    34 
    35 src/xdr/$(ARCH)/$(dirstamp):
    36         @$(mkdir_p) src/xdr/$(ARCH)
    37         @: > src/xdr/$(ARCH)/$(dirstamp)
    38 src/xdr/$(ARCH)/%.$(OBJEXT): src/xdr/%.c src/xdr/$(ARCH)/$(dirstamp)
    39         ${COMPILE} -o $@ -c $<
    40 src/xdr/$(ARCH)/libxdr.a: $(libxdr_OBJS)
    41         $(make-library)
     29EXTRA_LIBRARIES += o-debug/libxdr.a
     30o_debug_libxdr_a_SOURCES = $(libxdr_C_FILES)
     31o_debug_libxdr_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_DEBUG_V)
    4232
    4333man_MANS += src/xdr/xdr.3
    44 all-local: src/xdr/$(ARCH)/libxdr.a
     34all-local: $(ARCH)/libxdr.a
    4535endif
    4636
     
    6555
    6656if LIBRPC
    67 librpc_C_O_FILES = \
    68     $(librpc_C_FILES:src/rpc/%.c=src/rpc/$(ARCH)/%.$(OBJEXT))
    69 
    70 librpc_OBJS = $(librpc_C_O_FILES)
    71 
    7257librpc_a_CPPFLAGS = -D_RPC_read=read -D_RPC_write=write -D_RPC_close=close \
    7358    -D_RTEMS_RPC_INTERNAL_
    7459
    75 src/rpc/$(ARCH)/$(dirstamp):
    76         @$(mkdir_p) src/rpc/$(ARCH)
    77         @: > src/rpc/$(ARCH)/$(dirstamp)
    78 src/rpc/$(ARCH)/%.$(OBJEXT): src/rpc/%.c src/rpc/$(ARCH)/$(dirstamp)
    79         ${COMPILE} $(librpc_a_CPPFLAGS) -o $@ -c $<
    80 src/rpc/$(ARCH)/librpc.a: $(librpc_OBJS)
    81         $(make-library)
     60EXTRA_LIBRARIES += o-optimize/librpc.a
     61o_optimize_librpc_a_SOURCES = $(librpc_C_FILES)
     62o_optimize_librpc_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_OPTIMIZE_V) \
     63$(librpc_a_CPPFLAGS)
     64
     65EXTRA_LIBRARIES += o-debug/librpc.a
     66o_debug_librpc_a_SOURCES = $(librpc_C_FILES)
     67o_debug_librpc_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_DEBUG_V) \
     68$(librpc_a_CPPFLAGS)
    8269
    8370man_MANS += src/rpc/bindresvport.3 src/rpc/getrpcent.3 src/rpc/publickey.3 \
     
    8673    src/rpc/rpc.5 src/rpc/rstat.1 src/rpc/rtime.3
    8774
    88 all-local: src/rpc/$(ARCH)/librpc.a
     75all-local: $(ARCH)/librpc.a
    8976endif
    9077
    91 CLEANDIRS += src/rpc
    92 
    93 EXTRA_DIST += $(librpc_C_FILES) src/rpc/DISCLAIMER $(librpc_UNUSED_C_FILES)
     78EXTRA_DIST = $(librpc_C_FILES) src/rpc/DISCLAIMER $(librpc_UNUSED_C_FILES)
    9479
    9580EXTRA_DIST += src/rpc/PSD.doc/nfs.rfc.ms src/rpc/PSD.doc/rpc.prog.ms \
  • cpukit/posix/ChangeLog

    re7d110ba r07347cb  
     12004-01-07  Ralf Corsepius <corsepiu@faw.uni-ulm.de>
     2
     3        * Makefile.am: Build library using EXTRA_LIBRARIES and automake rules.
     4
    152003-12-12      Ralf Corsepius <corsepiu@faw.uni-ulm.de>
    26
  • cpukit/posix/Makefile.am

    re7d110ba r07347cb  
    44
    55include $(top_srcdir)/automake/multilib.am
    6 include $(top_srcdir)/automake/compile.am
    7 include $(top_srcdir)/automake/lib.am
     6include $(top_srcdir)/automake/amcompile.am
    87
    98EXTRA_DIST =
     
    148147    $(SEMAPHORE_C_FILES) src/sysconf.c $(TIME_C_FILES) $(TIMER_C_FILES) \
    149148    src/types.c $(ENOSYS_C_FILES) $(BUILD_FOR_NOW_C_FILES)
    150 OBJS = $(C_FILES:src/%.c=${ARCH}/%.$(OBJEXT))
    151 
    152 #
    153 # Add local stuff here using +=
    154 #
    155149
    156150AM_CPPFLAGS += -I$(top_builddir)
    157151AM_CPPFLAGS += -D__RTEMS_INSIDE__
    158152
     153EXTRA_LIBRARIES = o-optimize/libposix.a
     154o_optimize_libposix_a_SOURCES = $(C_FILES)
     155o_optimize_libposix_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_OPTIMIZE_V)
     156
     157EXTRA_LIBRARIES += o-debug/libposix.a
     158o_debug_libposix_a_SOURCES = $(C_FILES)
     159o_debug_libposix_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_DEBUG_V)
     160
    159161all-local: $(PREINSTALL_FILES) $(LIB)
    160162
    161 $(LIB): ${OBJS}
    162         $(make-library)
    163 endif
    164 
    165 ${ARCH}/%.$(OBJEXT): src/%.c $(ARCH)/$(dirstamp)
    166         ${COMPILE} -o $@ -c $<
     163endif
    167164
    168165# temporary so we can see how many things are left to implement
  • cpukit/rtems/ChangeLog

    re7d110ba r07347cb  
     12004-01-07  Ralf Corsepius <corsepiu@faw.uni-ulm.de>
     2
     3        * Makefile.am: Build library using EXTRA_LIBRARIES and automake rules.
     4
    152003-12-12      Ralf Corsepius <corsepiu@faw.uni-ulm.de>
    26
  • cpukit/rtems/Makefile.am

    re7d110ba r07347cb  
    44
    55include $(top_srcdir)/automake/multilib.am
    6 include $(top_srcdir)/automake/compile.am
    7 include $(top_srcdir)/automake/lib.am
     6include $(top_srcdir)/automake/amcompile.am
    87
    98# include
     
    5958
    6059## src
    61 LIB = $(ARCH)/librtems.a
    62 
    6360# We only build multiprocessing related files if HAS_MP was defined
    6461MP_C_FILES = src/eventmp.c src/mp.c src/msgmp.c src/partmp.c src/regionmp.c \
     
    123120endif
    124121
    125 OBJS = $(C_FILES:src/%.c=${ARCH}/%.$(OBJEXT))
    126 
    127 #
    128 # Add local stuff here using +=
    129 #
    130 
    131122AM_CPPFLAGS += -I$(top_builddir)
    132123AM_CPPFLAGS += -D__RTEMS_INSIDE__
    133124
    134 all-local: $(PREINSTALL_FILES) $(LIB)
    135 
    136 ${ARCH}/%.o: src/%.c $(ARCH)/$(dirstamp)
    137         ${COMPILE} -o $@ -c $<
    138 
    139 $(LIB): ${OBJS}
    140         $(make-library)
     125EXTRA_LIBRARIES = o-optimize/librtems.a
     126o_optimize_librtems_a_SOURCES = $(C_FILES)
     127o_optimize_librtems_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_OPTIMIZE_V)
     128
     129EXTRA_LIBRARIES += o-debug/librtems.a
     130o_debug_librtems_a_SOURCES = $(C_FILES)
     131o_debug_librtems_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_DEBUG_V)
     132
     133all-local: $(PREINSTALL_FILES) $(ARCH)/librtems.a
    141134
    142135EXTRA_DIST = $(STD_C_FILES) $(MP_C_FILES)
  • cpukit/sapi/ChangeLog

    re7d110ba r07347cb  
     12004-01-07  Ralf Corsepius <corsepiu@faw.uni-ulm.de>
     2
     3        * Makefile.am: Build library using EXTRA_LIBRARIES and automake rules.
     4
    152003-12-12      Ralf Corsepius <corsepiu@faw.uni-ulm.de>
    26
  • cpukit/sapi/Makefile.am

    re7d110ba r07347cb  
    44
    55include $(top_srcdir)/automake/multilib.am
    6 include $(top_srcdir)/automake/compile.am
    7 include $(top_srcdir)/automake/lib.am
     6include $(top_srcdir)/automake/amcompile.am
    87
    98include_HEADERS = include/confdefs.h
     
    2524## src
    2625
    27 LIB=$(ARCH)/libsapi.a
    28 
    2926EXTENSION_FILES = src/extension.c src/extensioncreate.c \
    3027    src/extensiondelete.c src/extensionident.c
    3128C_FILES = src/debug.c $(EXTENSION_FILES) src/fatal.c src/exinit.c src/io.c \
    3229    src/itronapi.c src/posixapi.c src/rtemsapi.c
    33 OBJS = $(C_FILES:src/%.c=${ARCH}/%.$(OBJEXT))
    34 
    35 #
    36 # Add local stuff here using +=
    37 #
    3830
    3931AM_CPPFLAGS += -I$(top_builddir)
    4032AM_CPPFLAGS += -D__RTEMS_INSIDE__
    4133
    42 all-local: $(PREINSTALL_FILES) $(LIB)
     34EXTRA_LIBRARIES = o-optimize/libsapi.a
     35o_optimize_libsapi_a_SOURCES = $(C_FILES)
     36o_optimize_libsapi_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_OPTIMIZE_V)
    4337
    44 $(LIB): ${OBJS}
    45         $(make-library)
     38EXTRA_LIBRARIES += o-debug/libsapi.a
     39o_debug_libsapi_a_SOURCES = $(C_FILES)
     40o_debug_libsapi_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_DEBUG_V)
    4641
    47 ${ARCH}/%.$(OBJEXT): src/%.c $(ARCH)/$(dirstamp)
    48         ${COMPILE} -o $@ -c $<
     42all-local: $(PREINSTALL_FILES) $(ARCH)/libsapi.a
    4943
    5044EXTRA_DIST += $(C_FILES)
  • cpukit/score/ChangeLog

    re7d110ba r07347cb  
     12004-01-07  Ralf Corsepius <corsepiu@faw.uni-ulm.de>
     2
     3        * Makefile.am: Build library using EXTRA_LIBRARIES and automake rules.
     4
    152003-12-16      Ralf Corsepius <corsepiu@faw.uni-ulm.de>
    26
  • cpukit/score/Makefile.am

    re7d110ba r07347cb  
    44
    55include $(top_srcdir)/automake/multilib.am
    6 include $(top_srcdir)/automake/compile.am
    7 include $(top_srcdir)/automake/lib.am
     6include $(top_srcdir)/automake/amcompile.am
    87
    98SUBDIRS = . cpu
     
    8281## src
    8382
    84 LIB=$(ARCH)/libscore.a
    85 
    8683# We only build multiprocessing related files if HAS_MP was defined
    8784MP_C_FILES = src/mpci.c src/objectmp.c src/threadmp.c
     
    147144C_FILES += $(MP_C_FILES)
    148145endif
    149 OBJS = $(C_FILES:src/%.c=${ARCH}/%.$(OBJEXT))
    150 
    151 #
    152 # Add local stuff here using +=
    153 #
    154146
    155147AM_CPPFLAGS += -D__RTEMS_INSIDE__
    156148
    157 $(LIB): ${OBJS}
    158         $(make-library)
    159 
    160 ${ARCH}/%.$(OBJEXT): src/%.c $(ARCH)/$(dirstamp)
    161         ${COMPILE} -o $@ -c $<
     149EXTRA_LIBRARIES = o-optimize/libscore.a
     150o_optimize_libscore_a_SOURCES = $(C_FILES)
     151o_optimize_libscore_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_OPTIMIZE_V)
     152
     153EXTRA_LIBRARIES += o-debug/libscore.a
     154o_debug_libscore_a_SOURCES = $(C_FILES)
     155o_debug_libscore_a_CPPFLAGS = $(AM_CPPFLAGS) $(CFLAGS_DEBUG_V)
    162156
    163157EXTRA_DIST += $(STD_C_FILES) $(MP_C_FILES) src/Unlimited.txt
    164158
    165 all-local: $(PREINSTALL_FILES) $(LIB)
     159all-local: $(PREINSTALL_FILES) $(ARCH)/libscore.a
    166160
    167161PREINSTALL_FILES =
Note: See TracChangeset for help on using the changeset viewer.